What is the function of acetanilide?
What is the function of acetanilide?
acetanilide, synthetic organic compound introduced in therapy in 1886 as a fever-reducing drug. Its effectiveness in relieving pain was discovered soon thereafter, and it was used as an alternative to aspirin for many years in treating such common complaints as headache, menstrual cramps, and rheumatism.
Is aniline a functional group?
Aniline is an organic compound with the formula C6H5NH2. Consisting of a phenyl group attached to an amino group, aniline is the simplest aromatic amine….CHEBI:17296 – aniline.
| ChEBI Name | aniline |
|---|---|
| Definition | A primary arylamine in which an amino functional group is substituted for one of the benzene hydrogens. |
Does acetanilide have an amine group?
Main Difference – Aniline vs Acetanilide Aniline is an aromatic amine since it is composed of a phenyl group attached to an amine group. Acetanilide is an aromatic amide. It is very weak base, and the basicity is even less than water. It is a solid compound at room temperature.
Is acetanilide an amide?
ACETANILIDE is an amide. Flammable gases are formed by the reaction of organic amides with strong reducing agents.
What is the structure of acetanilide?
C8H9NOAcetanilide / Formula
How is acetanilide formed?
Acetanilide is prepared from aniline when it reacts with acetic anhydride/glacial acetic acid in the presence of zinc dust. A mixture of aniline, glacial acetic acid, acetic anhydride and zinc dust is refluxed under anhydrous condition and then poured the mixture into ice cold water to get acetic anhydride precipitate.
What are the functional groups in aniline?
Aniline is a primary arylamine in which an amino functional group is substituted for one of the benzene hydrogens. It is a primary arylamine and a member of anilines.
Which of the following is functional group of aniline?
amino group -NH2
The functional group of aniline is the amino group -NH2. The amino group is attached to one of the carbons in the aromatic benzene ring.
What type of amide is in acetanilide?
Acetanilide is an organic chemical compound (meaning it’s composed of carbon and hydrogen mostly) that is classified as an amide in terms of its functional group. This means that it has the carbonyl group (carbon-oxygen double bond) bonded directly to a nitrogen atom.
What is the chemical structure of acetanilide?
| IUPAC Name | N-phenylacetamide |
|---|---|
| Molecular Formula | C8H9NO |
| Molar Mass | 135.166 g/mol |
| InChI | InChI=1S/C8H9NO/c1-7(10)9-8-5-3-2-4-6-8/h2-6H,1H3,(H,9,10) |
| InChI Key | FZERHIULMFGESH-UHFFFAOYSA-N |
What kind of amide is acetanilide?
What is chemical formula of acetanilide?
What type of organic compound is acetanilide?
amide
Acetanilide is an organic chemical compound that’s classified as an amide in terms of its functional group, and additionally contains an aromatic ring. Acetanilide only contains four types of atoms, which include carbon, hydrogen, nitrogen, and oxygen. It’s chemical formula is usually written as C6 H5 NHCOCH3.
What is the functional group in amines?
The functional group of an amine is a nitrogen atom with a lone pair of electrons and with one, two, or three alkyl or aryl groups attached. The amide. functional group has a carbonyl group joined to a nitrogen atom from ammonia or an amine.
What is the formula of Acetanilide?
Which is functional group of amide?
Amide Functional Group An amide is a functional group that consists of a carbonyl group and nitrogen atom and can be derived from the various functional group known as carboxylic acid.
What is the functional group of amide?
An amide is a functional group that consists of a carbonyl group and nitrogen atom and can be derived from the various functional group known as carboxylic acid.
What is the functional group present in benzamide?
Functional group : −O−NH2.
The first structure is the common representation of the acetanilide structure. The nitrogen in the amide group has a lone pair of electrons. It is a nucleophile. It can accept hydrogen ions or donate a lone pair of electrons to electrophiles. The compound exhibits basic chemical nature.
Is acetanilide a nucleophile or a base?
Acetanilide is a weak base with a pH value near 8. It is a weak base because of the resonance structures it shows. The nitrogen atom of the amide group does not act as a proton acceptor or a nucleophile.
What is the difference between acetanilide and acetylarylamine?
Acetanilide is a white to gray solid. (NTP, 1992) N-Acetylarylamine is an odourless solid chemical of leaf or flake-like appearance. It is also known as acetanilide, N-phenylacetamide, acetanil, or acetanilid, and was formerly known by the trade name Antifebrin.
Why is acetanilide so toxic?
In 1948, Julius Axelrod and Bernard Brodie discovered that acetanilide is much more toxic in these applications than other drugs, causing methemoglobinemia and ultimately doing damage to the liver and kidneys.